C23H35N3O7S — CID 170655740
N-[(14R,16S)-4-(hydroxymethyl)-14-methyl-12-oxo-7,11,19-trioxa-13,25-diazatetracyclo[18.2.2.12,6.013,17]pentacosa-2(25),3,5-trien-16-yl]methanesulfonamide (PubChem CID 170655740) has the molecular formula C23H35N3O7S and a molecular weight of 497.61 g/mol. Its IUPAC name is N-[(14R,16S)-4-(hydroxymethyl)-14-methyl-12-oxo-7,11,19-trioxa-13,25-diazatetracyclo[18.2.2.12,6.013,17]pentacosa-2(25),3,5-trien-16-yl]methanesulfonamide.
| Compound Name | N-[(14R,16S)-4-(hydroxymethyl)-14-methyl-12-oxo-7,11,19-trioxa-13,25-diazatetracyclo[18.2.2.12,6.013,17]pentacosa-2(25),3,5-trien-16-yl]methanesulfonamide |
|---|---|
| PubChem CID | 170655740 |
| Molecular Formula | C23H35N3O7S |
| Molecular Weight | 497.61 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | N-[(14R,16S)-4-(hydroxymethyl)-14-methyl-12-oxo-7,11,19-trioxa-13,25-diazatetracyclo[18.2.2.12,6.013,17]pentacosa-2(25),3,5-trien-16-yl]methanesulfonamide |
| SMILES | C[C@@H]1C[C@H](NS(C)(=O)=O)C2COC3CCC(CC3)c3cc(CO)cc(n3)OCCCOC(=O)N21 |
| InChI | InChI=1S/C23H35N3O7S/c1-15-10-20(25-34(2,29)30)21-14-33-18-6-4-17(5-7-18)19-11-16(13-27)12-22(24-19)31-8-3-9-32-23(28)26(15)21/h11-12,15,17-18,20-21,25,27H,3-10,13-14H2,1-2H3/t15-,17?,18?,20+,21?/m1/s1 |
| InChIKey | GHIAZNRTQREPLZ-MESJWQKXSA-N |
| XLogP | 1.92 |
| TPSA | 127.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.61 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |