C23H36N4O6S — CID 167081034
N-(4-methoxy-14-methyl-12-oxo-11,19-dioxa-7,13,25-triazatetracyclo[18.2.2.12,6.013,17]pentacosa-2(25),3,5-trien-16-yl)methanesulfonamide (PubChem CID 167081034) has the molecular formula C23H36N4O6S and a molecular weight of 496.63 g/mol. Its IUPAC name is N-(4-methoxy-14-methyl-12-oxo-11,19-dioxa-7,13,25-triazatetracyclo[18.2.2.12,6.013,17]pentacosa-2(25),3,5-trien-16-yl)methanesulfonamide.
| Compound Name | N-(4-methoxy-14-methyl-12-oxo-11,19-dioxa-7,13,25-triazatetracyclo[18.2.2.12,6.013,17]pentacosa-2(25),3,5-trien-16-yl)methanesulfonamide |
|---|---|
| PubChem CID | 167081034 |
| Molecular Formula | C23H36N4O6S |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | N-(4-methoxy-14-methyl-12-oxo-11,19-dioxa-7,13,25-triazatetracyclo[18.2.2.12,6.013,17]pentacosa-2(25),3,5-trien-16-yl)methanesulfonamide |
| SMILES | COc1cc2nc(c1)C1CCC(CC1)OCC1C(NS(C)(=O)=O)CC(C)N1C(=O)OCCCN2 |
| InChI | InChI=1S/C23H36N4O6S/c1-15-11-20(26-34(3,29)30)21-14-33-17-7-5-16(6-8-17)19-12-18(31-2)13-22(25-19)24-9-4-10-32-23(28)27(15)21/h12-13,15-17,20-21,26H,4-11,14H2,1-3H3,(H,24,25) |
| InChIKey | HAPIUHJQBAQKKA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 119.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |