C19H29NO — CID 167081844
(2S)-2-(2,3-dimethylpyrrolidin-1-yl)-2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]cyclohexan-1-one (PubChem CID 167081844) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is (2S)-2-(2,3-dimethylpyrrolidin-1-yl)-2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]cyclohexan-1-one.
| Compound Name | (2S)-2-(2,3-dimethylpyrrolidin-1-yl)-2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 167081844 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | (2S)-2-(2,3-dimethylpyrrolidin-1-yl)-2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]cyclohexan-1-one |
| SMILES | C=C(/C=C\C=C/C)[C@@]1(N2CCC(C)C2C)CCCCC1=O |
| InChI | InChI=1S/C19H29NO/c1-5-6-7-10-16(3)19(13-9-8-11-18(19)21)20-14-12-15(2)17(20)4/h5-7,10,15,17H,3,8-9,11-14H2,1-2,4H3/b6-5-,10-7-/t15?,17?,19-/m0/s1 |
| InChIKey | AYHNFXTWHPPNSY-ISIAHHQOSA-N |
| XLogP | 4.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|