C12H21N3O2S — CID 167083680
butan-2-yl 4-(ethenylcarbamothioyl)piperazine-1-carboxylate (PubChem CID 167083680) has the molecular formula C12H21N3O2S and a molecular weight of 271.39 g/mol. Its IUPAC name is butan-2-yl 4-(ethenylcarbamothioyl)piperazine-1-carboxylate.
| Compound Name | butan-2-yl 4-(ethenylcarbamothioyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 167083680 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | butan-2-yl 4-(ethenylcarbamothioyl)piperazine-1-carboxylate |
| SMILES | C=CNC(=S)N1CCN(C(=O)OC(C)CC)CC1 |
| InChI | InChI=1S/C12H21N3O2S/c1-4-10(3)17-12(16)15-8-6-14(7-9-15)11(18)13-5-2/h5,10H,2,4,6-9H2,1,3H3,(H,13,18) |
| InChIKey | BCIGBWUPDPIWQG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|