About 1-(methylamino)propan-2-yl morpholine-4-carboxylate
1-(methylamino)propan-2-yl morpholine-4-carboxylate (PubChem CID 79338020) has the molecular formula C9H18N2O3
and a molecular weight of 202.25 g/mol. Its IUPAC name is 1-(methylamino)propan-2-yl morpholine-4-carboxylate.
Molecular Properties
| Compound Name | 1-(methylamino)propan-2-yl morpholine-4-carboxylate |
| PubChem CID | 79338020 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | 1-(methylamino)propan-2-yl morpholine-4-carboxylate |
| SMILES | CNCC(C)OC(=O)N1CCOCC1 |
| InChI | InChI=1S/C9H18N2O3/c1-8(7-10-2)14-9(12)11-3-5-13-6-4-11/h8,10H,3-7H2,1-2H3 |
| InChIKey | NUEBGGDDXWJRHK-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(methylamino)propan-2-yl morpholine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(methylamino)propan-2-yl morpholine-4-carboxylate?
The IUPAC name of 1-(methylamino)propan-2-yl morpholine-4-carboxylate (CID 79338020) is 1-(methylamino)propan-2-yl morpholine-4-carboxylate.
What is the SMILES notation for 1-(methylamino)propan-2-yl morpholine-4-carboxylate?
The canonical SMILES for 1-(methylamino)propan-2-yl morpholine-4-carboxylate is CNCC(C)OC(=O)N1CCOCC1.
What is the InChIKey of 1-(methylamino)propan-2-yl morpholine-4-carboxylate?
The InChIKey is NUEBGGDDXWJRHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O3/c1-8(7-10-2)14-9(12)11-3-5-13-6-4-11/h8,10H,3-7H2,1-2H3.
What are the key properties of 1-(methylamino)propan-2-yl morpholine-4-carboxylate?
1-(methylamino)propan-2-yl morpholine-4-carboxylate has a molecular weight of 202.25 g/mol, XLogP of 0.06, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(methylamino)propan-2-yl morpholine-4-carboxylate is sourced from PubChem (CID 79338020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).