C15H22NP — CID 167088322
dimethyl-methylidene-[(3-propyl-1H-indol-4-yl)methyl]-λ5-phosphane (PubChem CID 167088322) has the molecular formula C15H22NP and a molecular weight of 247.32 g/mol. Its IUPAC name is dimethyl-methylidene-[(3-propyl-1H-indol-4-yl)methyl]-λ5-phosphane.
| Compound Name | dimethyl-methylidene-[(3-propyl-1H-indol-4-yl)methyl]-λ5-phosphane |
|---|---|
| PubChem CID | 167088322 |
| Molecular Formula | C15H22NP |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | dimethyl-methylidene-[(3-propyl-1H-indol-4-yl)methyl]-λ5-phosphane |
| SMILES | C=P(C)(C)Cc1cccc2[nH]cc(CCC)c12 |
| InChI | InChI=1S/C15H22NP/c1-5-7-12-10-16-14-9-6-8-13(15(12)14)11-17(2,3)4/h6,8-10,16H,2,5,7,11H2,1,3-4H3 |
| InChIKey | GURQLRAEMOADAC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|