C19H25NO — CID 167089337
5-[2-(2-aminophenyl)propyl]-2-tert-butylphenol (PubChem CID 167089337) has the molecular formula C19H25NO and a molecular weight of 283.41 g/mol. Its IUPAC name is 5-[2-(2-aminophenyl)propyl]-2-tert-butylphenol.
| Compound Name | 5-[2-(2-aminophenyl)propyl]-2-tert-butylphenol |
|---|---|
| PubChem CID | 167089337 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 5-[2-(2-aminophenyl)propyl]-2-tert-butylphenol |
| SMILES | CC(Cc1ccc(C(C)(C)C)c(O)c1)c1ccccc1N |
| InChI | InChI=1S/C19H25NO/c1-13(15-7-5-6-8-17(15)20)11-14-9-10-16(18(21)12-14)19(2,3)4/h5-10,12-13,21H,11,20H2,1-4H3 |
| InChIKey | QDLOSDGJBNUKLY-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|