C19H26N2O4 — CID 139947806
2-[3-amino-4-[2-[5-amino-2-hydroxy-4-(2-hydroxyethyl)phenyl]propan-2-yl]phenyl]ethane-1,1-diol (PubChem CID 139947806) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-[3-amino-4-[2-[5-amino-2-hydroxy-4-(2-hydroxyethyl)phenyl]propan-2-yl]phenyl]ethane-1,1-diol.
| Compound Name | 2-[3-amino-4-[2-[5-amino-2-hydroxy-4-(2-hydroxyethyl)phenyl]propan-2-yl]phenyl]ethane-1,1-diol |
|---|---|
| PubChem CID | 139947806 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 2-[3-amino-4-[2-[5-amino-2-hydroxy-4-(2-hydroxyethyl)phenyl]propan-2-yl]phenyl]ethane-1,1-diol |
| SMILES | CC(C)(c1ccc(CC(O)O)cc1N)c1cc(N)c(CCO)cc1O |
| InChI | InChI=1S/C19H26N2O4/c1-19(2,13-4-3-11(7-16(13)21)8-18(24)25)14-10-15(20)12(5-6-22)9-17(14)23/h3-4,7,9-10,18,22-25H,5-6,8,20-21H2,1-2H3 |
| InChIKey | ZUBOZXSVAHCNIS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|