C24H21N3O — CID 167090781
2-[2,3-bis(ethenyl)indol-1-yl]-6-methyl-7-[(1Z)-2-methylbuta-1,3-dienyl]furo[3,2-d]pyrimidine (PubChem CID 167090781) has the molecular formula C24H21N3O and a molecular weight of 367.45 g/mol. Its IUPAC name is 2-[2,3-bis(ethenyl)indol-1-yl]-6-methyl-7-[(1Z)-2-methylbuta-1,3-dienyl]furo[3,2-d]pyrimidine.
| Compound Name | 2-[2,3-bis(ethenyl)indol-1-yl]-6-methyl-7-[(1Z)-2-methylbuta-1,3-dienyl]furo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 167090781 |
| Molecular Formula | C24H21N3O |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 2-[2,3-bis(ethenyl)indol-1-yl]-6-methyl-7-[(1Z)-2-methylbuta-1,3-dienyl]furo[3,2-d]pyrimidine |
| SMILES | C=C/C(C)=C\c1c(C)oc2cnc(-n3c(C=C)c(C=C)c4ccccc43)nc12 |
| InChI | InChI=1S/C24H21N3O/c1-6-15(4)13-19-16(5)28-22-14-25-24(26-23(19)22)27-20(8-3)17(7-2)18-11-9-10-12-21(18)27/h6-14H,1-3H2,4-5H3/b15-13- |
| InChIKey | SPOJICCCZATVTI-SQFISAMPSA-N |
| XLogP | 6.35 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|