C10H16N2O2 — CID 167091633
1-(5-methyl-2-oxa-5,8-diazaspiro[3.5]nonan-8-yl)prop-2-en-1-one (PubChem CID 167091633) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 1-(5-methyl-2-oxa-5,8-diazaspiro[3.5]nonan-8-yl)prop-2-en-1-one.
| Compound Name | 1-(5-methyl-2-oxa-5,8-diazaspiro[3.5]nonan-8-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 167091633 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 1-(5-methyl-2-oxa-5,8-diazaspiro[3.5]nonan-8-yl)prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(C)C2(COC2)C1 |
| InChI | InChI=1S/C10H16N2O2/c1-3-9(13)12-5-4-11(2)10(6-12)7-14-8-10/h3H,1,4-8H2,2H3 |
| InChIKey | ZXMYWEOICRDEBF-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|