C13H16N2O3 — CID 171550386
1-[8-(5-methylfuran-2-yl)-1-oxa-5,8-diazaspiro[2.5]octan-5-yl]prop-2-en-1-one (PubChem CID 171550386) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 1-[8-(5-methylfuran-2-yl)-1-oxa-5,8-diazaspiro[2.5]octan-5-yl]prop-2-en-1-one.
| Compound Name | 1-[8-(5-methylfuran-2-yl)-1-oxa-5,8-diazaspiro[2.5]octan-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 171550386 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 1-[8-(5-methylfuran-2-yl)-1-oxa-5,8-diazaspiro[2.5]octan-5-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2ccc(C)o2)C2(CO2)C1 |
| InChI | InChI=1S/C13H16N2O3/c1-3-11(16)14-6-7-15(13(8-14)9-17-13)12-5-4-10(2)18-12/h3-5H,1,6-9H2,2H3 |
| InChIKey | KXMQIZIDETYKDD-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 49.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|