C9H12FN — CID 167092326
N-[(3E)-3-fluoropenta-1,3-dien-2-yl]but-3-en-2-imine (PubChem CID 167092326) has the molecular formula C9H12FN and a molecular weight of 153.20 g/mol. Its IUPAC name is N-[(3E)-3-fluoropenta-1,3-dien-2-yl]but-3-en-2-imine.
| Compound Name | N-[(3E)-3-fluoropenta-1,3-dien-2-yl]but-3-en-2-imine |
|---|---|
| PubChem CID | 167092326 |
| Molecular Formula | C9H12FN |
| Molecular Weight | 153.20 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | N-[(3E)-3-fluoropenta-1,3-dien-2-yl]but-3-en-2-imine |
| SMILES | C=C/C(C)=N/C(=C)/C(F)=C\C |
| InChI | InChI=1S/C9H12FN/c1-5-7(3)11-8(4)9(10)6-2/h5-6H,1,4H2,2-3H3/b9-6+,11-7+ |
| InChIKey | AZQGXRKKSZMGMA-QHAIXMIYSA-N |
| XLogP | 3.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.20 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|