C21H22Cl3N3O3 — CID 167095560
7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-N-(oxan-4-yl)-6,7-dihydro-2,6-naphthyridin-1-amine (PubChem CID 167095560) has the molecular formula C21H22Cl3N3O3 and a molecular weight of 470.78 g/mol. Its IUPAC name is 7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-N-(oxan-4-yl)-6,7-dihydro-2,6-naphthyridin-1-amine.
| Compound Name | 7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-N-(oxan-4-yl)-6,7-dihydro-2,6-naphthyridin-1-amine |
|---|---|
| PubChem CID | 167095560 |
| Molecular Formula | C21H22Cl3N3O3 |
| Molecular Weight | 470.78 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | 7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-N-(oxan-4-yl)-6,7-dihydro-2,6-naphthyridin-1-amine |
| SMILES | COc1cc(OC)c(Cl)c(-c2cc3c(c(NC4CCOCC4)n2)=CC(Cl)NC=3)c1Cl |
| InChI | InChI=1S/C21H22Cl3N3O3/c1-28-15-9-16(29-2)20(24)18(19(15)23)14-7-11-10-25-17(22)8-13(11)21(27-14)26-12-3-5-30-6-4-12/h7-10,12,17,25H,3-6H2,1-2H3,(H,26,27) |
| InChIKey | GNXVNGSKWPUXBY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 64.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.78 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|