C8H10N8 — CID 167095813
1-N,4-N-dihydrazinylidenebenzene-1,4-dicarboximidamide (PubChem CID 167095813) has the molecular formula C8H10N8 and a molecular weight of 218.22 g/mol. Its IUPAC name is 1-N,4-N-dihydrazinylidenebenzene-1,4-dicarboximidamide.
| Compound Name | 1-N,4-N-dihydrazinylidenebenzene-1,4-dicarboximidamide |
|---|---|
| PubChem CID | 167095813 |
| Molecular Formula | C8H10N8 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | 1-N,4-N-dihydrazinylidenebenzene-1,4-dicarboximidamide |
| SMILES | [H]/N=C(\N=N\N)c1ccc(C(=N/[H])/N=N/N)cc1 |
| InChI | InChI=1S/C8H10N8/c9-7(13-15-11)5-1-2-6(4-3-5)8(10)14-16-12/h1-4H,(H3,9,11,13)(H3,10,12,14) |
| InChIKey | GFZMFDYWFMPBSV-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 149.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|