C30H50N6O4 — CID 167096775
N-[3-[4-[amino-[(Z)-2-amino-2-(3-aminophenyl)ethenyl]amino]butyl]-5,6,10,14-tetramethyl-13,15-dioxo-1-oxa-6-azacyclopentadec-4-yl]formamide (PubChem CID 167096775) has the molecular formula C30H50N6O4 and a molecular weight of 558.77 g/mol. Its IUPAC name is N-[3-[4-[amino-[(Z)-2-amino-2-(3-aminophenyl)ethenyl]amino]butyl]-5,6,10,14-tetramethyl-13,15-dioxo-1-oxa-6-azacyclopentadec-4-yl]formamide.
| Compound Name | N-[3-[4-[amino-[(Z)-2-amino-2-(3-aminophenyl)ethenyl]amino]butyl]-5,6,10,14-tetramethyl-13,15-dioxo-1-oxa-6-azacyclopentadec-4-yl]formamide |
|---|---|
| PubChem CID | 167096775 |
| Molecular Formula | C30H50N6O4 |
| Molecular Weight | 558.77 g/mol |
| Exact Mass | 558.39 |
| IUPAC Name | N-[3-[4-[amino-[(Z)-2-amino-2-(3-aminophenyl)ethenyl]amino]butyl]-5,6,10,14-tetramethyl-13,15-dioxo-1-oxa-6-azacyclopentadec-4-yl]formamide |
| SMILES | CC1CCCN(C)C(C)C(NC=O)C(CCCCN(N)/C=C(\N)c2cccc(N)c2)COC(=O)C(C)C(=O)CC1 |
| InChI | InChI=1S/C30H50N6O4/c1-21-9-8-15-35(4)23(3)29(34-20-37)25(19-40-30(39)22(2)28(38)14-13-21)10-5-6-16-36(33)18-27(32)24-11-7-12-26(31)17-24/h7,11-12,17-18,20-23,25,29H,5-6,8-10,13-16,19,31-33H2,1-4H3,(H,34,37)/b27-18- |
| InChIKey | DQXNNDMSAJFDHK-IMRQLAEWSA-N |
| XLogP | 2.88 |
| TPSA | 157.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.77 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|