C34H37ClN2O2S2 — CID 167097044
N-[4-[(4R)-2-chloro-6-prop-2-enoyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-yl]cyclohexyl]-N-[(4S,6S)-4-(2-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]prop-2-enamide (PubChem CID 167097044) has the molecular formula C34H37ClN2O2S2 and a molecular weight of 605.27 g/mol. Its IUPAC name is N-[4-[(4R)-2-chloro-6-prop-2-enoyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-yl]cyclohexyl]-N-[(4S,6S)-4-(2-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]prop-2-enamide.
| Compound Name | N-[4-[(4R)-2-chloro-6-prop-2-enoyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-yl]cyclohexyl]-N-[(4S,6S)-4-(2-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 167097044 |
| Molecular Formula | C34H37ClN2O2S2 |
| Molecular Weight | 605.27 g/mol |
| Exact Mass | 604.20 |
| IUPAC Name | N-[4-[(4R)-2-chloro-6-prop-2-enoyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-yl]cyclohexyl]-N-[(4S,6S)-4-(2-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]prop-2-enamide |
| SMILES | C=CC(=O)N1Cc2sc(Cl)cc2[C@@H](C2CCC(N(C(=O)C=C)[C@@H]3Cc4sccc4[C@H](c4ccccc4C)C3)CC2)C1 |
| InChI | InChI=1S/C34H37ClN2O2S2/c1-4-33(38)36-19-29(28-18-32(35)41-31(28)20-36)22-10-12-23(13-11-22)37(34(39)5-2)24-16-27(25-9-7-6-8-21(25)3)26-14-15-40-30(26)17-24/h4-9,14-15,18,22-24,27,29H,1-2,10-13,16-17,19-20H2,3H3/t22?,23?,24-,27-,29+/m0/s1 |
| InChIKey | ITUCMFNIUHHQPB-WBQJWAGQSA-N |
| XLogP | 8.10 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.27 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|