C20H24ClN5O — CID 167097172
2-[[1-amino-2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]ethylidene]amino]benzamide (PubChem CID 167097172) has the molecular formula C20H24ClN5O and a molecular weight of 385.90 g/mol. Its IUPAC name is 2-[[1-amino-2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]ethylidene]amino]benzamide.
| Compound Name | 2-[[1-amino-2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]ethylidene]amino]benzamide |
|---|---|
| PubChem CID | 167097172 |
| Molecular Formula | C20H24ClN5O |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 2-[[1-amino-2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]ethylidene]amino]benzamide |
| SMILES | NC(=O)c1ccccc1/N=C(\N)CN1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H24ClN5O/c21-16-7-5-15(6-8-16)13-25-9-11-26(12-10-25)14-19(22)24-18-4-2-1-3-17(18)20(23)27/h1-8H,9-14H2,(H2,22,24)(H2,23,27) |
| InChIKey | QQWLPCZTPOYAGA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|