C20H15BrF7NO5S — CID 167097218
methyl 2-[(4-bromo-2-ethylsulfonylbenzoyl)amino]-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzoate (PubChem CID 167097218) has the molecular formula C20H15BrF7NO5S and a molecular weight of 594.30 g/mol. Its IUPAC name is methyl 2-[(4-bromo-2-ethylsulfonylbenzoyl)amino]-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzoate.
| Compound Name | methyl 2-[(4-bromo-2-ethylsulfonylbenzoyl)amino]-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzoate |
|---|---|
| PubChem CID | 167097218 |
| Molecular Formula | C20H15BrF7NO5S |
| Molecular Weight | 594.30 g/mol |
| Exact Mass | 592.97 |
| IUPAC Name | methyl 2-[(4-bromo-2-ethylsulfonylbenzoyl)amino]-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzoate |
| SMILES | CCS(=O)(=O)c1cc(Br)ccc1C(=O)Nc1ccc(C(F)(C(F)(F)F)C(F)(F)F)cc1C(=O)OC |
| InChI | InChI=1S/C20H15BrF7NO5S/c1-3-35(32,33)15-9-11(21)5-6-12(15)16(30)29-14-7-4-10(8-13(14)17(31)34-2)18(22,19(23,24)25)20(26,27)28/h4-9H,3H2,1-2H3,(H,29,30) |
| InChIKey | QVHHFIHUNVMFGK-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.30 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |