C22H17ClF7NO6S — CID 167097286
methyl 2-[acetyl-(4-chloro-2-ethylsulfonylbenzoyl)amino]-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzoate (PubChem CID 167097286) has the molecular formula C22H17ClF7NO6S and a molecular weight of 591.89 g/mol. Its IUPAC name is methyl 2-[acetyl-(4-chloro-2-ethylsulfonylbenzoyl)amino]-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzoate.
| Compound Name | methyl 2-[acetyl-(4-chloro-2-ethylsulfonylbenzoyl)amino]-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzoate |
|---|---|
| PubChem CID | 167097286 |
| Molecular Formula | C22H17ClF7NO6S |
| Molecular Weight | 591.89 g/mol |
| Exact Mass | 591.04 |
| IUPAC Name | methyl 2-[acetyl-(4-chloro-2-ethylsulfonylbenzoyl)amino]-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzoate |
| SMILES | CCS(=O)(=O)c1cc(Cl)ccc1C(=O)N(C(C)=O)c1ccc(C(F)(C(F)(F)F)C(F)(F)F)cc1C(=O)OC |
| InChI | InChI=1S/C22H17ClF7NO6S/c1-4-38(35,36)17-10-13(23)6-7-14(17)18(33)31(11(2)32)16-8-5-12(9-15(16)19(34)37-3)20(24,21(25,26)27)22(28,29)30/h5-10H,4H2,1-3H3 |
| InChIKey | PQHWWZIGFNSPLV-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.89 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |