C22H15F10NO4S — CID 167097298
methyl 2-[acetyl-[2-methylsulfanyl-4-(trifluoromethyl)benzoyl]amino]-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzoate (PubChem CID 167097298) has the molecular formula C22H15F10NO4S and a molecular weight of 579.41 g/mol. Its IUPAC name is methyl 2-[acetyl-[2-methylsulfanyl-4-(trifluoromethyl)benzoyl]amino]-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzoate.
| Compound Name | methyl 2-[acetyl-[2-methylsulfanyl-4-(trifluoromethyl)benzoyl]amino]-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzoate |
|---|---|
| PubChem CID | 167097298 |
| Molecular Formula | C22H15F10NO4S |
| Molecular Weight | 579.41 g/mol |
| Exact Mass | 579.06 |
| IUPAC Name | methyl 2-[acetyl-[2-methylsulfanyl-4-(trifluoromethyl)benzoyl]amino]-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzoate |
| SMILES | COC(=O)c1cc(C(F)(C(F)(F)F)C(F)(F)F)ccc1N(C(C)=O)C(=O)c1ccc(C(F)(F)F)cc1SC |
| InChI | InChI=1S/C22H15F10NO4S/c1-10(34)33(17(35)13-6-4-12(20(24,25)26)9-16(13)38-3)15-7-5-11(8-14(15)18(36)37-2)19(23,21(27,28)29)22(30,31)32/h4-9H,1-3H3 |
| InChIKey | ZAZVWDBFYFUIJB-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.41 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |