C23H20F7NO6S — CID 134509855
methyl 2-[acetyl-(2-ethylsulfonyl-4-methylbenzoyl)amino]-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzoate (PubChem CID 134509855) has the molecular formula C23H20F7NO6S and a molecular weight of 571.47 g/mol. Its IUPAC name is methyl 2-[acetyl-(2-ethylsulfonyl-4-methylbenzoyl)amino]-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzoate.
| Compound Name | methyl 2-[acetyl-(2-ethylsulfonyl-4-methylbenzoyl)amino]-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzoate |
|---|---|
| PubChem CID | 134509855 |
| Molecular Formula | C23H20F7NO6S |
| Molecular Weight | 571.47 g/mol |
| Exact Mass | 571.09 |
| IUPAC Name | methyl 2-[acetyl-(2-ethylsulfonyl-4-methylbenzoyl)amino]-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzoate |
| SMILES | CCS(=O)(=O)c1cc(C)ccc1C(=O)N(C(C)=O)c1ccc(C(F)(C(F)(F)F)C(F)(F)F)cc1C(=O)OC |
| InChI | InChI=1S/C23H20F7NO6S/c1-5-38(35,36)18-10-12(2)6-8-15(18)19(33)31(13(3)32)17-9-7-14(11-16(17)20(34)37-4)21(24,22(25,26)27)23(28,29)30/h6-11H,5H2,1-4H3 |
| InChIKey | CZPOIQARSUCEQT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |