C19H24N8O2S — CID 167097567
1-[(3aR)-5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-3-(3-methoxy-1,2,4-thiadiazol-5-yl)urea (PubChem CID 167097567) has the molecular formula C19H24N8O2S and a molecular weight of 428.52 g/mol. Its IUPAC name is 1-[(3aR)-5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-3-(3-methoxy-1,2,4-thiadiazol-5-yl)urea.
| Compound Name | 1-[(3aR)-5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-3-(3-methoxy-1,2,4-thiadiazol-5-yl)urea |
|---|---|
| PubChem CID | 167097567 |
| Molecular Formula | C19H24N8O2S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 1-[(3aR)-5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-3-(3-methoxy-1,2,4-thiadiazol-5-yl)urea |
| SMILES | COc1nsc(NC(=O)NC2CC3CC(N(C)c4ncnc5[nH]ccc45)C[C@H]3C2)n1 |
| InChI | InChI=1S/C19H24N8O2S/c1-27(16-14-3-4-20-15(14)21-9-22-16)13-7-10-5-12(6-11(10)8-13)23-17(28)24-19-25-18(29-2)26-30-19/h3-4,9-13H,5-8H2,1-2H3,(H,20,21,22)(H2,23,24,25,26,28)/t10-,11?,12?,13?/m1/s1 |
| InChIKey | GETHTTHLBYBGNB-PEWWYSNMSA-N |
| XLogP | 2.63 |
| TPSA | 120.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |