C5H10NO6P — CID 167104505
[(3S,5S)-1-hydroxy-5-methoxy-2-oxopyrrolidin-3-yl]phosphonic acid (PubChem CID 167104505) has the molecular formula C5H10NO6P and a molecular weight of 211.11 g/mol. Its IUPAC name is [(3S,5S)-1-hydroxy-5-methoxy-2-oxopyrrolidin-3-yl]phosphonic acid.
| Compound Name | [(3S,5S)-1-hydroxy-5-methoxy-2-oxopyrrolidin-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 167104505 |
| Molecular Formula | C5H10NO6P |
| Molecular Weight | 211.11 g/mol |
| Exact Mass | 211.02 |
| IUPAC Name | [(3S,5S)-1-hydroxy-5-methoxy-2-oxopyrrolidin-3-yl]phosphonic acid |
| SMILES | CO[C@H]1C[C@H](P(=O)(O)O)C(=O)N1O |
| InChI | InChI=1S/C5H10NO6P/c1-12-4-2-3(13(9,10)11)5(7)6(4)8/h3-4,8H,2H2,1H3,(H2,9,10,11)/t3-,4-/m0/s1 |
| InChIKey | KBJHKBZDSYHRHL-IMJSIDKUSA-N |
| XLogP | -0.87 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.11 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|