C8H19N3O2 — CID 152969309
4,6-dimethoxy-1,3-dimethyl-1,3-diazinan-2-amine (PubChem CID 152969309) has the molecular formula C8H19N3O2 and a molecular weight of 189.26 g/mol. Its IUPAC name is 4,6-dimethoxy-1,3-dimethyl-1,3-diazinan-2-amine.
| Compound Name | 4,6-dimethoxy-1,3-dimethyl-1,3-diazinan-2-amine |
|---|---|
| PubChem CID | 152969309 |
| Molecular Formula | C8H19N3O2 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 4,6-dimethoxy-1,3-dimethyl-1,3-diazinan-2-amine |
| SMILES | COC1CC(OC)N(C)C(N)N1C |
| InChI | InChI=1S/C8H19N3O2/c1-10-6(12-3)5-7(13-4)11(2)8(10)9/h6-8H,5,9H2,1-4H3 |
| InChIKey | USDKQDPSBJIDPH-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 50.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |