C18H35BrO2 — CID 167106408
(3S,7S)-1-bromo-3-ethyl-11-hydroxy-4,7,11-trimethyltridecan-2-one (PubChem CID 167106408) has the molecular formula C18H35BrO2 and a molecular weight of 363.38 g/mol. Its IUPAC name is (3S,7S)-1-bromo-3-ethyl-11-hydroxy-4,7,11-trimethyltridecan-2-one.
| Compound Name | (3S,7S)-1-bromo-3-ethyl-11-hydroxy-4,7,11-trimethyltridecan-2-one |
|---|---|
| PubChem CID | 167106408 |
| Molecular Formula | C18H35BrO2 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | (3S,7S)-1-bromo-3-ethyl-11-hydroxy-4,7,11-trimethyltridecan-2-one |
| SMILES | CCC(C(=O)CBr)C(C)CC[C@@H](C)CCCC(C)(O)CC |
| InChI | InChI=1S/C18H35BrO2/c1-6-16(17(20)13-19)15(4)11-10-14(3)9-8-12-18(5,21)7-2/h14-16,21H,6-13H2,1-5H3/t14-,15?,16?,18?/m0/s1 |
| InChIKey | HPYNCFSICDZIKD-JFPDKAJLSA-N |
| XLogP | 5.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|