C18H24N2O3 — CID 167111435
[(4aR,7R,8aS)-2,3,4,4a,5,7,8,8a-octahydropyrano[4,3-b][1,4]oxazin-7-yl]-[(1S)-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl]methanone (PubChem CID 167111435) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is [(4aR,7R,8aS)-2,3,4,4a,5,7,8,8a-octahydropyrano[4,3-b][1,4]oxazin-7-yl]-[(1S)-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl]methanone.
| Compound Name | [(4aR,7R,8aS)-2,3,4,4a,5,7,8,8a-octahydropyrano[4,3-b][1,4]oxazin-7-yl]-[(1S)-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
|---|---|
| PubChem CID | 167111435 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | [(4aR,7R,8aS)-2,3,4,4a,5,7,8,8a-octahydropyrano[4,3-b][1,4]oxazin-7-yl]-[(1S)-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
| SMILES | C[C@H]1c2ccccc2CCN1C(=O)[C@H]1C[C@@H]2OCCN[C@@H]2CO1 |
| InChI | InChI=1S/C18H24N2O3/c1-12-14-5-3-2-4-13(14)6-8-20(12)18(21)17-10-16-15(11-23-17)19-7-9-22-16/h2-5,12,15-17,19H,6-11H2,1H3/t12-,15+,16-,17+/m0/s1 |
| InChIKey | VLUZSVAVIZEUAB-NKKGCODLSA-N |
| XLogP | 1.28 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |