C11H5F5O2 — CID 167114678
6-(1,1,2,2,2-pentafluoroethyl)chromen-2-one (PubChem CID 167114678) has the molecular formula C11H5F5O2 and a molecular weight of 264.15 g/mol. Its IUPAC name is 6-(1,1,2,2,2-pentafluoroethyl)chromen-2-one.
| Compound Name | 6-(1,1,2,2,2-pentafluoroethyl)chromen-2-one |
|---|---|
| PubChem CID | 167114678 |
| Molecular Formula | C11H5F5O2 |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 6-(1,1,2,2,2-pentafluoroethyl)chromen-2-one |
| SMILES | O=c1ccc2cc(C(F)(F)C(F)(F)F)ccc2o1 |
| InChI | InChI=1S/C11H5F5O2/c12-10(13,11(14,15)16)7-2-3-8-6(5-7)1-4-9(17)18-8/h1-5H |
| InChIKey | SJPWXMZHMAAODW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|