C11H8F3NO2 — CID 66511155
6-[(1S)-1-amino-2,2,2-trifluoroethyl]chromen-2-one (PubChem CID 66511155) has the molecular formula C11H8F3NO2 and a molecular weight of 243.18 g/mol. Its IUPAC name is 6-[(1S)-1-amino-2,2,2-trifluoroethyl]chromen-2-one.
| Compound Name | 6-[(1S)-1-amino-2,2,2-trifluoroethyl]chromen-2-one |
|---|---|
| PubChem CID | 66511155 |
| Molecular Formula | C11H8F3NO2 |
| Molecular Weight | 243.18 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 6-[(1S)-1-amino-2,2,2-trifluoroethyl]chromen-2-one |
| SMILES | N[C@@H](c1ccc2oc(=O)ccc2c1)C(F)(F)F |
| InChI | InChI=1S/C11H8F3NO2/c12-11(13,14)10(15)7-1-3-8-6(5-7)2-4-9(16)17-8/h1-5,10H,15H2/t10-/m0/s1 |
| InChIKey | SCKQBOZQIBZGPT-JTQLQIEISA-N |
| XLogP | 2.36 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.18 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|