C16H22FN3O3S — CID 167115977
(2R)-2-amino-3-[[3-fluoro-5-(5-propan-2-yl-1,2-thiazolidin-4-yl)benzoyl]amino]propanoic acid (PubChem CID 167115977) has the molecular formula C16H22FN3O3S and a molecular weight of 355.44 g/mol. Its IUPAC name is (2R)-2-amino-3-[[3-fluoro-5-(5-propan-2-yl-1,2-thiazolidin-4-yl)benzoyl]amino]propanoic acid.
| Compound Name | (2R)-2-amino-3-[[3-fluoro-5-(5-propan-2-yl-1,2-thiazolidin-4-yl)benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 167115977 |
| Molecular Formula | C16H22FN3O3S |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | (2R)-2-amino-3-[[3-fluoro-5-(5-propan-2-yl-1,2-thiazolidin-4-yl)benzoyl]amino]propanoic acid |
| SMILES | CC(C)C1SNCC1c1cc(F)cc(C(=O)NC[C@@H](N)C(=O)O)c1 |
| InChI | InChI=1S/C16H22FN3O3S/c1-8(2)14-12(6-20-24-14)9-3-10(5-11(17)4-9)15(21)19-7-13(18)16(22)23/h3-5,8,12-14,20H,6-7,18H2,1-2H3,(H,19,21)(H,22,23)/t12?,13-,14?/m1/s1 |
| InChIKey | BXQVULDJEBELCT-ROKHWSDSSA-N |
| XLogP | 1.33 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|