C39H54N4O9S — CID 167117534
N'-[3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)-1-oxobutan-2-yl]-N-[2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-1,3-dioxoisoindol-4-yl]octanediamide (PubChem CID 167117534) has the molecular formula C39H54N4O9S and a molecular weight of 754.95 g/mol. Its IUPAC name is N'-[3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)-1-oxobutan-2-yl]-N-[2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-1,3-dioxoisoindol-4-yl]octanediamide.
| Compound Name | N'-[3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)-1-oxobutan-2-yl]-N-[2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-1,3-dioxoisoindol-4-yl]octanediamide |
|---|---|
| PubChem CID | 167117534 |
| Molecular Formula | C39H54N4O9S |
| Molecular Weight | 754.95 g/mol |
| Exact Mass | 754.36 |
| IUPAC Name | N'-[3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)-1-oxobutan-2-yl]-N-[2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-1,3-dioxoisoindol-4-yl]octanediamide |
| SMILES | CCOc1cc(C(CS(C)(=O)=O)N2C(=O)c3cccc(NC(=O)CCCCCCC(=O)NC(C(=O)N4CCCC4C)C(C)(C)C)c3C2=O)ccc1OC |
| InChI | InChI=1S/C39H54N4O9S/c1-8-52-31-23-26(20-21-30(31)51-6)29(24-53(7,49)50)43-36(46)27-16-13-17-28(34(27)37(43)47)40-32(44)18-11-9-10-12-19-33(45)41-35(39(3,4)5)38(48)42-22-14-15-25(42)2/h13,16-17,20-21,23,25,29,35H,8-12,14-15,18-19,22,24H2,1-7H3,(H,40,44)(H,41,45) |
| InChIKey | JZCPBECYMKRWEY-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 168.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.95 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|