C20H26O4S — CID 167118156
7-[[(5E)-4H-1,3-benzodioxocin-6-yl]sulfanyl]heptyl prop-2-enoate (PubChem CID 167118156) has the molecular formula C20H26O4S and a molecular weight of 362.49 g/mol. Its IUPAC name is 7-[[(5E)-4H-1,3-benzodioxocin-6-yl]sulfanyl]heptyl prop-2-enoate.
| Compound Name | 7-[[(5E)-4H-1,3-benzodioxocin-6-yl]sulfanyl]heptyl prop-2-enoate |
|---|---|
| PubChem CID | 167118156 |
| Molecular Formula | C20H26O4S |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 7-[[(5E)-4H-1,3-benzodioxocin-6-yl]sulfanyl]heptyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCCS/C1=C/COCOc2ccccc21 |
| InChI | InChI=1S/C20H26O4S/c1-2-20(21)23-13-8-4-3-5-9-15-25-19-12-14-22-16-24-18-11-7-6-10-17(18)19/h2,6-7,10-12H,1,3-5,8-9,13-16H2/b19-12+ |
| InChIKey | VKFHMLIMFAHBPK-XDHOZWIPSA-N |
| XLogP | 4.81 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|