C15H19NO3 — CID 139929905
4-(2,4-dihydro-1,3-benzoxazin-3-yl)butyl prop-2-enoate (PubChem CID 139929905) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 4-(2,4-dihydro-1,3-benzoxazin-3-yl)butyl prop-2-enoate.
| Compound Name | 4-(2,4-dihydro-1,3-benzoxazin-3-yl)butyl prop-2-enoate |
|---|---|
| PubChem CID | 139929905 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 4-(2,4-dihydro-1,3-benzoxazin-3-yl)butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCN1COc2ccccc2C1 |
| InChI | InChI=1S/C15H19NO3/c1-2-15(17)18-10-6-5-9-16-11-13-7-3-4-8-14(13)19-12-16/h2-4,7-8H,1,5-6,9-12H2 |
| InChIKey | NIFMMKZJCOCBCI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|