C20H21NO3 — CID 139929903
3-(6-phenyl-2,4-dihydro-1,3-benzoxazin-3-yl)propyl prop-2-enoate (PubChem CID 139929903) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is 3-(6-phenyl-2,4-dihydro-1,3-benzoxazin-3-yl)propyl prop-2-enoate.
| Compound Name | 3-(6-phenyl-2,4-dihydro-1,3-benzoxazin-3-yl)propyl prop-2-enoate |
|---|---|
| PubChem CID | 139929903 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 3-(6-phenyl-2,4-dihydro-1,3-benzoxazin-3-yl)propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCN1COc2ccc(-c3ccccc3)cc2C1 |
| InChI | InChI=1S/C20H21NO3/c1-2-20(22)23-12-6-11-21-14-18-13-17(9-10-19(18)24-15-21)16-7-4-3-5-8-16/h2-5,7-10,13H,1,6,11-12,14-15H2 |
| InChIKey | ICXKYIZVPJIQQE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|