C18H21BrN2O3 — CID 167118348
ethyl 7-bromo-6-(3,5-dimethylmorpholin-4-yl)quinoline-4-carboxylate (PubChem CID 167118348) has the molecular formula C18H21BrN2O3 and a molecular weight of 393.28 g/mol. Its IUPAC name is ethyl 7-bromo-6-(3,5-dimethylmorpholin-4-yl)quinoline-4-carboxylate.
| Compound Name | ethyl 7-bromo-6-(3,5-dimethylmorpholin-4-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 167118348 |
| Molecular Formula | C18H21BrN2O3 |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | ethyl 7-bromo-6-(3,5-dimethylmorpholin-4-yl)quinoline-4-carboxylate |
| SMILES | CCOC(=O)c1ccnc2cc(Br)c(N3C(C)COCC3C)cc12 |
| InChI | InChI=1S/C18H21BrN2O3/c1-4-24-18(22)13-5-6-20-16-8-15(19)17(7-14(13)16)21-11(2)9-23-10-12(21)3/h5-8,11-12H,4,9-10H2,1-3H3 |
| InChIKey | YXIVUDRUWPINML-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |