C18H27N5O15P2 — CID 167120784
[[(2S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] [4-[(1R)-1,2-dihydroxyethyl]-2,3,5-trihydroxy-6-oxabicyclo[3.2.0]heptan-7-yl] hydrogen phosphate (PubChem CID 167120784) has the molecular formula C18H27N5O15P2 and a molecular weight of 615.38 g/mol. Its IUPAC name is [[(2S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] [4-[(1R)-1,2-dihydroxyethyl]-2,3,5-trihydroxy-6-oxabicyclo[3.2.0]heptan-7-yl] hydrogen phosphate.
| Compound Name | [[(2S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] [4-[(1R)-1,2-dihydroxyethyl]-2,3,5-trihydroxy-6-oxabicyclo[3.2.0]heptan-7-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 167120784 |
| Molecular Formula | C18H27N5O15P2 |
| Molecular Weight | 615.38 g/mol |
| Exact Mass | 615.10 |
| IUPAC Name | [[(2S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] [4-[(1R)-1,2-dihydroxyethyl]-2,3,5-trihydroxy-6-oxabicyclo[3.2.0]heptan-7-yl] hydrogen phosphate |
| SMILES | Nc1nc2c(ncn2[C@H]2CC[C@@H](COP(=O)(O)OP(=O)(O)OC3OC4(O)C(C(O)CO)C(O)C(O)C34)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C18H27N5O15P2/c19-17-21-14-11(15(28)22-17)20-5-23(14)8-2-1-6(35-8)4-34-39(30,31)38-40(32,33)37-16-10-13(27)12(26)9(7(25)3-24)18(10,29)36-16/h5-10,12-13,16,24-27,29H,1-4H2,(H,30,31)(H,32,33)(H3,19,21,22,28)/t6-,7?,8+,9?,10?,12?,13?,16?,18?/m0/s1 |
| InChIKey | HJHFRVZIPYKJJS-YIYQTFBKSA-N |
| XLogP | -3.00 |
| TPSA | 311.49 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.38 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|