C22H21N6O14P3 — CID 135626026
[[5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] [hydroxy-(7-oxophenoxazin-3-yl)oxyphosphoryl] hydrogen phosphate (PubChem CID 135626026) has the molecular formula C22H21N6O14P3 and a molecular weight of 686.36 g/mol. Its IUPAC name is [[5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] [hydroxy-(7-oxophenoxazin-3-yl)oxyphosphoryl] hydrogen phosphate.
| Compound Name | [[5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] [hydroxy-(7-oxophenoxazin-3-yl)oxyphosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 135626026 |
| Molecular Formula | C22H21N6O14P3 |
| Molecular Weight | 686.36 g/mol |
| Exact Mass | 686.03 |
| IUPAC Name | [[5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] [hydroxy-(7-oxophenoxazin-3-yl)oxyphosphoryl] hydrogen phosphate |
| SMILES | Nc1nc2c(ncn2C2CCC(COP(=O)(O)OP(=O)(O)OP(=O)(O)Oc3ccc4nc5ccc(=O)cc-5oc4c3)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C22H21N6O14P3/c23-22-26-20-19(21(30)27-22)24-10-28(20)18-6-3-13(38-18)9-37-43(31,32)41-45(35,36)42-44(33,34)40-12-2-5-15-17(8-12)39-16-7-11(29)1-4-14(16)25-15/h1-2,4-5,7-8,10,13,18H,3,6,9H2,(H,31,32)(H,33,34)(H,35,36)(H3,23,26,27,30) |
| InChIKey | VSCMDGJEMORLMD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 290.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|