C19H30N6O14P2S — CID 167120923
[[(2R,3S,4R,5R)-4-amino-5-(6-aminopurin-9-yl)-3-methoxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] [4-[(1R)-1,2-dihydroxyethyl]-2,3,5-trihydroxy-6-oxabicyclo[3.2.0]heptan-7-yl] hydrogen phosphate (PubChem CID 167120923) has the molecular formula C19H30N6O14P2S and a molecular weight of 660.49 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-4-amino-5-(6-aminopurin-9-yl)-3-methoxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] [4-[(1R)-1,2-dihydroxyethyl]-2,3,5-trihydroxy-6-oxabicyclo[3.2.0]heptan-7-yl] hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-4-amino-5-(6-aminopurin-9-yl)-3-methoxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] [4-[(1R)-1,2-dihydroxyethyl]-2,3,5-trihydroxy-6-oxabicyclo[3.2.0]heptan-7-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 167120923 |
| Molecular Formula | C19H30N6O14P2S |
| Molecular Weight | 660.49 g/mol |
| Exact Mass | 660.10 |
| IUPAC Name | [[(2R,3S,4R,5R)-4-amino-5-(6-aminopurin-9-yl)-3-methoxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] [4-[(1R)-1,2-dihydroxyethyl]-2,3,5-trihydroxy-6-oxabicyclo[3.2.0]heptan-7-yl] hydrogen phosphate |
| SMILES | CO[C@H]1[C@@H](N)[C@H](n2cnc3c(N)ncnc32)O[C@@H]1COP(O)(=S)OP(=O)(O)OC1OC2(O)C(C(O)CO)C(O)C(O)C12 |
| InChI | InChI=1S/C19H30N6O14P2S/c1-34-14-7(36-17(10(14)20)25-5-24-11-15(21)22-4-23-16(11)25)3-35-41(33,42)39-40(31,32)38-18-9-13(29)12(28)8(6(27)2-26)19(9,30)37-18/h4-10,12-14,17-18,26-30H,2-3,20H2,1H3,(H,31,32)(H,33,42)(H2,21,22,23)/t6?,7-,8?,9?,10-,12?,13?,14-,17-,18?,19?,41?/m1/s1 |
| InChIKey | FVSIULYWDSTVQH-PACRPKDYSA-N |
| XLogP | -3.62 |
| TPSA | 309.70 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.49 |
| LogP ≤ 5 | -3.62 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|