C17H20ClN5S2 — CID 167121508
4-butyl-3-[[4-(chloromethyl)-2,3-dihydro-1,3-thiazol-2-yl]methyl]-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine (PubChem CID 167121508) has the molecular formula C17H20ClN5S2 and a molecular weight of 393.97 g/mol. Its IUPAC name is 4-butyl-3-[[4-(chloromethyl)-2,3-dihydro-1,3-thiazol-2-yl]methyl]-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine.
| Compound Name | 4-butyl-3-[[4-(chloromethyl)-2,3-dihydro-1,3-thiazol-2-yl]methyl]-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine |
|---|---|
| PubChem CID | 167121508 |
| Molecular Formula | C17H20ClN5S2 |
| Molecular Weight | 393.97 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 4-butyl-3-[[4-(chloromethyl)-2,3-dihydro-1,3-thiazol-2-yl]methyl]-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine |
| SMILES | CCCCc1nc2c(N)nc3ccsc3c2n1CC1NC(CCl)=CS1 |
| InChI | InChI=1S/C17H20ClN5S2/c1-2-3-4-12-22-14-15(16-11(5-6-24-16)21-17(14)19)23(12)8-13-20-10(7-18)9-25-13/h5-6,9,13,20H,2-4,7-8H2,1H3,(H2,19,21) |
| InChIKey | SAEPBLZBYBNJGX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.97 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|