C26H31N5O2S — CID 168966210
benzyl 4-[(7-amino-4-butyl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-3-yl)methyl]piperidine-1-carboxylate (PubChem CID 168966210) has the molecular formula C26H31N5O2S and a molecular weight of 477.63 g/mol. Its IUPAC name is benzyl 4-[(7-amino-4-butyl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-3-yl)methyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[(7-amino-4-butyl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-3-yl)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 168966210 |
| Molecular Formula | C26H31N5O2S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | benzyl 4-[(7-amino-4-butyl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-3-yl)methyl]piperidine-1-carboxylate |
| SMILES | CCCCc1nc2c(N)nc3ccsc3c2n1CC1CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C26H31N5O2S/c1-2-3-9-21-29-22-23(24-20(12-15-34-24)28-25(22)27)31(21)16-18-10-13-30(14-11-18)26(32)33-17-19-7-5-4-6-8-19/h4-8,12,15,18H,2-3,9-11,13-14,16-17H2,1H3,(H2,27,28) |
| InChIKey | ONEZSWGOPVLRMP-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |