About benzyl pyrrolidine-1-carboxylate;5-bromo-3,6-diethylpyrazin-2-amine
benzyl pyrrolidine-1-carboxylate;5-bromo-3,6-diethylpyrazin-2-amine (PubChem CID 142247225) has the molecular formula C20H27BrN4O2
and a molecular weight of 435.37 g/mol. Its IUPAC name is benzyl pyrrolidine-1-carboxylate;5-bromo-3,6-diethylpyrazin-2-amine.
Molecular Properties
| Compound Name | benzyl pyrrolidine-1-carboxylate;5-bromo-3,6-diethylpyrazin-2-amine |
| PubChem CID | 142247225 |
| Molecular Formula | C20H27BrN4O2 |
| Molecular Weight | 435.37 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | benzyl pyrrolidine-1-carboxylate;5-bromo-3,6-diethylpyrazin-2-amine |
| SMILES | CCc1nc(Br)c(CC)nc1N.O=C(OCc1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C12H15NO2.C8H12BrN3/c14-12(13-8-4-5-9-13)15-10-11-6-2-1-3-7-11;1-3-5-7(9)11-6(4-2)8(10)12-5/h1-3,6-7H,4-5,8-10H2;3-4H2,1-2H3,(H2,10,12) |
| InChIKey | CQGBCQYMUDMGDV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzyl pyrrolidine-1-carboxylate;5-bromo-3,6-diethylpyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl pyrrolidine-1-carboxylate;5-bromo-3,6-diethylpyrazin-2-amine?
The IUPAC name of benzyl pyrrolidine-1-carboxylate;5-bromo-3,6-diethylpyrazin-2-amine (CID 142247225) is benzyl pyrrolidine-1-carboxylate;5-bromo-3,6-diethylpyrazin-2-amine.
What is the SMILES notation for benzyl pyrrolidine-1-carboxylate;5-bromo-3,6-diethylpyrazin-2-amine?
The canonical SMILES for benzyl pyrrolidine-1-carboxylate;5-bromo-3,6-diethylpyrazin-2-amine is CCc1nc(Br)c(CC)nc1N.O=C(OCc1ccccc1)N1CCCC1.
What is the InChIKey of benzyl pyrrolidine-1-carboxylate;5-bromo-3,6-diethylpyrazin-2-amine?
The InChIKey is CQGBCQYMUDMGDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2.C8H12BrN3/c14-12(13-8-4-5-9-13)15-10-11-6-2-1-3-7-11;1-3-5-7(9)11-6(4-2)8(10)12-5/h1-3,6-7H,4-5,8-10H2;3-4H2,1-2H3,(H2,10,12).
What are the key properties of benzyl pyrrolidine-1-carboxylate;5-bromo-3,6-diethylpyrazin-2-amine?
benzyl pyrrolidine-1-carboxylate;5-bromo-3,6-diethylpyrazin-2-amine has a molecular weight of 435.37 g/mol, XLogP of 4.37, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl pyrrolidine-1-carboxylate;5-bromo-3,6-diethylpyrazin-2-amine is sourced from PubChem (CID 142247225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).