C20H28N4O2 — CID 142247145
benzyl pyrrolidine-1-carboxylate;3,6-diethylpyrazin-2-amine (PubChem CID 142247145) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is benzyl pyrrolidine-1-carboxylate;3,6-diethylpyrazin-2-amine.
| Compound Name | benzyl pyrrolidine-1-carboxylate;3,6-diethylpyrazin-2-amine |
|---|---|
| PubChem CID | 142247145 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | benzyl pyrrolidine-1-carboxylate;3,6-diethylpyrazin-2-amine |
| SMILES | CCc1cnc(CC)c(N)n1.O=C(OCc1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C12H15NO2.C8H13N3/c14-12(13-8-4-5-9-13)15-10-11-6-2-1-3-7-11;1-3-6-5-10-7(4-2)8(9)11-6/h1-3,6-7H,4-5,8-10H2;5H,3-4H2,1-2H3,(H2,9,11) |
| InChIKey | NNBKVMQUTUSGOJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |