C27H40N6O5S — CID 175591193
2-[2-[3-[4-[(7-amino-4-butyl-11-methyl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-3-yl)methyl]piperidin-1-yl]-3-oxopropoxy]ethoxy]ethyl carbamate (PubChem CID 175591193) has the molecular formula C27H40N6O5S and a molecular weight of 560.72 g/mol. Its IUPAC name is 2-[2-[3-[4-[(7-amino-4-butyl-11-methyl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-3-yl)methyl]piperidin-1-yl]-3-oxopropoxy]ethoxy]ethyl carbamate.
| Compound Name | 2-[2-[3-[4-[(7-amino-4-butyl-11-methyl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-3-yl)methyl]piperidin-1-yl]-3-oxopropoxy]ethoxy]ethyl carbamate |
|---|---|
| PubChem CID | 175591193 |
| Molecular Formula | C27H40N6O5S |
| Molecular Weight | 560.72 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | 2-[2-[3-[4-[(7-amino-4-butyl-11-methyl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-3-yl)methyl]piperidin-1-yl]-3-oxopropoxy]ethoxy]ethyl carbamate |
| SMILES | CCCCc1nc2c(N)nc3cc(C)sc3c2n1CC1CCN(C(=O)CCOCCOCCOC(N)=O)CC1 |
| InChI | InChI=1S/C27H40N6O5S/c1-3-4-5-21-31-23-24(25-20(30-26(23)28)16-18(2)39-25)33(21)17-19-6-9-32(10-7-19)22(34)8-11-36-12-13-37-14-15-38-27(29)35/h16,19H,3-15,17H2,1-2H3,(H2,28,30)(H2,29,35) |
| InChIKey | LGCOCSKOIQAMKC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.72 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|