C18H24N4O2S — CID 175435262
4-(4-butyl-11-methyl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaen-3-yl)butyl carbamate (PubChem CID 175435262) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is 4-(4-butyl-11-methyl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaen-3-yl)butyl carbamate.
| Compound Name | 4-(4-butyl-11-methyl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaen-3-yl)butyl carbamate |
|---|---|
| PubChem CID | 175435262 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 4-(4-butyl-11-methyl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaen-3-yl)butyl carbamate |
| SMILES | CCCCc1nc2cnc3cc(C)sc3c2n1CCCCOC(N)=O |
| InChI | InChI=1S/C18H24N4O2S/c1-3-4-7-15-21-14-11-20-13-10-12(2)25-17(13)16(14)22(15)8-5-6-9-24-18(19)23/h10-11H,3-9H2,1-2H3,(H2,19,23) |
| InChIKey | SXSAGZCEFHPHDW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|