C20H22ClF2NO3 — CID 167131602
(E)-1-[8-chloro-3-(2-hydroxyethyl)indolizin-1-yl]-4-(3,3-difluoro-1-hydroxycyclohexyl)but-2-en-1-one (PubChem CID 167131602) has the molecular formula C20H22ClF2NO3 and a molecular weight of 397.85 g/mol. Its IUPAC name is (E)-1-[8-chloro-3-(2-hydroxyethyl)indolizin-1-yl]-4-(3,3-difluoro-1-hydroxycyclohexyl)but-2-en-1-one.
| Compound Name | (E)-1-[8-chloro-3-(2-hydroxyethyl)indolizin-1-yl]-4-(3,3-difluoro-1-hydroxycyclohexyl)but-2-en-1-one |
|---|---|
| PubChem CID | 167131602 |
| Molecular Formula | C20H22ClF2NO3 |
| Molecular Weight | 397.85 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | (E)-1-[8-chloro-3-(2-hydroxyethyl)indolizin-1-yl]-4-(3,3-difluoro-1-hydroxycyclohexyl)but-2-en-1-one |
| SMILES | O=C(/C=C/CC1(O)CCCC(F)(F)C1)c1cc(CCO)n2cccc(Cl)c12 |
| InChI | InChI=1S/C20H22ClF2NO3/c21-16-4-2-10-24-14(6-11-25)12-15(18(16)24)17(26)5-1-7-19(27)8-3-9-20(22,23)13-19/h1-2,4-5,10,12,25,27H,3,6-9,11,13H2/b5-1+ |
| InChIKey | RJUVDFPBMIXBAJ-ORCRQEGFSA-N |
| XLogP | 4.20 |
| TPSA | 61.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.85 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|