C18H22BClF2N2O2 — CID 174014228
8-chloro-N-[(3,3-difluoroborinan-1-yl)methyl]-3-(2-methoxyethyl)indolizine-1-carboxamide (PubChem CID 174014228) has the molecular formula C18H22BClF2N2O2 and a molecular weight of 382.65 g/mol. Its IUPAC name is 8-chloro-N-[(3,3-difluoroborinan-1-yl)methyl]-3-(2-methoxyethyl)indolizine-1-carboxamide.
| Compound Name | 8-chloro-N-[(3,3-difluoroborinan-1-yl)methyl]-3-(2-methoxyethyl)indolizine-1-carboxamide |
|---|---|
| PubChem CID | 174014228 |
| Molecular Formula | C18H22BClF2N2O2 |
| Molecular Weight | 382.65 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 8-chloro-N-[(3,3-difluoroborinan-1-yl)methyl]-3-(2-methoxyethyl)indolizine-1-carboxamide |
| SMILES | COCCc1cc(C(=O)NCB2CCCC(F)(F)C2)c2c(Cl)cccn12 |
| InChI | InChI=1S/C18H22BClF2N2O2/c1-26-9-5-13-10-14(16-15(20)4-2-8-24(13)16)17(25)23-12-19-7-3-6-18(21,22)11-19/h2,4,8,10H,3,5-7,9,11-12H2,1H3,(H,23,25) |
| InChIKey | OPJOMIGWVPPIDX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.65 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|