C13H14ClNO2 — CID 145010898
1-[8-chloro-3-(2-methoxyethyl)indolizin-1-yl]ethanone (PubChem CID 145010898) has the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. Its IUPAC name is 1-[8-chloro-3-(2-methoxyethyl)indolizin-1-yl]ethanone.
| Compound Name | 1-[8-chloro-3-(2-methoxyethyl)indolizin-1-yl]ethanone |
|---|---|
| PubChem CID | 145010898 |
| Molecular Formula | C13H14ClNO2 |
| Molecular Weight | 251.71 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 1-[8-chloro-3-(2-methoxyethyl)indolizin-1-yl]ethanone |
| SMILES | COCCc1cc(C(C)=O)c2c(Cl)cccn12 |
| InChI | InChI=1S/C13H14ClNO2/c1-9(16)11-8-10(5-7-17-2)15-6-3-4-12(14)13(11)15/h3-4,6,8H,5,7H2,1-2H3 |
| InChIKey | WUVCAHGPLGLNLI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.71 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |