C22H30ClFN2O2 — CID 167131653
1-[[1-[8-chloro-3-(2-ethoxyethyl)indolizin-1-yl]ethenylamino]methyl]-3-fluoro-3-methylcyclohexan-1-ol (PubChem CID 167131653) has the molecular formula C22H30ClFN2O2 and a molecular weight of 408.95 g/mol. Its IUPAC name is 1-[[1-[8-chloro-3-(2-ethoxyethyl)indolizin-1-yl]ethenylamino]methyl]-3-fluoro-3-methylcyclohexan-1-ol.
| Compound Name | 1-[[1-[8-chloro-3-(2-ethoxyethyl)indolizin-1-yl]ethenylamino]methyl]-3-fluoro-3-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 167131653 |
| Molecular Formula | C22H30ClFN2O2 |
| Molecular Weight | 408.95 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 1-[[1-[8-chloro-3-(2-ethoxyethyl)indolizin-1-yl]ethenylamino]methyl]-3-fluoro-3-methylcyclohexan-1-ol |
| SMILES | C=C(NCC1(O)CCCC(C)(F)C1)c1cc(CCOCC)n2cccc(Cl)c12 |
| InChI | InChI=1S/C22H30ClFN2O2/c1-4-28-12-8-17-13-18(20-19(23)7-5-11-26(17)20)16(2)25-15-22(27)10-6-9-21(3,24)14-22/h5,7,11,13,25,27H,2,4,6,8-10,12,14-15H2,1,3H3 |
| InChIKey | KJAFWWOTGZDNAV-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 45.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.95 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|