C22H29ClN2O3 — CID 145010917
1-[8-chloro-3-(2-methoxyethyl)indolizin-1-yl]-3-(1-hydroxy-3,3-dimethylcyclohexyl)-2-iminopropan-1-one (PubChem CID 145010917) has the molecular formula C22H29ClN2O3 and a molecular weight of 404.94 g/mol. Its IUPAC name is 1-[8-chloro-3-(2-methoxyethyl)indolizin-1-yl]-3-(1-hydroxy-3,3-dimethylcyclohexyl)-2-iminopropan-1-one.
| Compound Name | 1-[8-chloro-3-(2-methoxyethyl)indolizin-1-yl]-3-(1-hydroxy-3,3-dimethylcyclohexyl)-2-iminopropan-1-one |
|---|---|
| PubChem CID | 145010917 |
| Molecular Formula | C22H29ClN2O3 |
| Molecular Weight | 404.94 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 1-[8-chloro-3-(2-methoxyethyl)indolizin-1-yl]-3-(1-hydroxy-3,3-dimethylcyclohexyl)-2-iminopropan-1-one |
| SMILES | [H]/N=C(/CC1(O)CCCC(C)(C)C1)C(=O)c1cc(CCOC)n2cccc(Cl)c12 |
| InChI | InChI=1S/C22H29ClN2O3/c1-21(2)8-5-9-22(27,14-21)13-18(24)20(26)16-12-15(7-11-28-3)25-10-4-6-17(23)19(16)25/h4,6,10,12,24,27H,5,7-9,11,13-14H2,1-3H3/b24-18- |
| InChIKey | LWZHEIKLAWDFGU-MOHJPFBDSA-N |
| XLogP | 4.71 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.94 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|