C22H36N4O4S — CID 167138117
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[4-[3-(pent-4-ynoylamino)propoxy]butyl]pentanamide (PubChem CID 167138117) has the molecular formula C22H36N4O4S and a molecular weight of 452.62 g/mol. Its IUPAC name is 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[4-[3-(pent-4-ynoylamino)propoxy]butyl]pentanamide.
| Compound Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[4-[3-(pent-4-ynoylamino)propoxy]butyl]pentanamide |
|---|---|
| PubChem CID | 167138117 |
| Molecular Formula | C22H36N4O4S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[4-[3-(pent-4-ynoylamino)propoxy]butyl]pentanamide |
| SMILES | C#CCCC(=O)NCCCOCCCCNC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21 |
| InChI | InChI=1S/C22H36N4O4S/c1-2-3-10-19(27)24-13-8-15-30-14-7-6-12-23-20(28)11-5-4-9-18-21-17(16-31-18)25-22(29)26-21/h1,17-18,21H,3-16H2,(H,23,28)(H,24,27)(H2,25,26,29)/t17-,18-,21-/m0/s1 |
| InChIKey | LPMKXRAXAZWPDG-WFXMLNOXSA-N |
| XLogP | 1.54 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|