C22H27NO4 — CID 167140795
(2S)-2-(9H-fluoren-9-ylmethoxymethylamino)-3-[(2-methylpropan-2-yl)oxy]propanoic acid (PubChem CID 167140795) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is (2S)-2-(9H-fluoren-9-ylmethoxymethylamino)-3-[(2-methylpropan-2-yl)oxy]propanoic acid.
| Compound Name | (2S)-2-(9H-fluoren-9-ylmethoxymethylamino)-3-[(2-methylpropan-2-yl)oxy]propanoic acid |
|---|---|
| PubChem CID | 167140795 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (2S)-2-(9H-fluoren-9-ylmethoxymethylamino)-3-[(2-methylpropan-2-yl)oxy]propanoic acid |
| SMILES | CC(C)(C)OC[C@H](NCOCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C22H27NO4/c1-22(2,3)27-13-20(21(24)25)23-14-26-12-19-17-10-6-4-8-15(17)16-9-5-7-11-18(16)19/h4-11,19-20,23H,12-14H2,1-3H3,(H,24,25)/t20-/m0/s1 |
| InChIKey | GUPFCUUUUSKRRM-FQEVSTJZSA-N |
| XLogP | 3.63 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|